About (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone
(4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone (PubChem CID 155980501) has the molecular formula C18H18N4OS
and a molecular weight of 338.44 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone |
| PubChem CID | 155980501 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1ncsc1C(=O)N1CCC(c2ccc3cccnc3n2)CC1 |
| InChI | InChI=1S/C18H18N4OS/c1-12-16(24-11-20-12)18(23)22-9-6-13(7-10-22)15-5-4-14-3-2-8-19-17(14)21-15/h2-5,8,11,13H,6-7,9-10H2,1H3 |
| InChIKey | NWWGGDAQFXZGSX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone?
The IUPAC name of (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone (CID 155980501) is (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone.
What is the SMILES notation for (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone?
The canonical SMILES for (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone is Cc1ncsc1C(=O)N1CCC(c2ccc3cccnc3n2)CC1.
What is the InChIKey of (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone?
The InChIKey is NWWGGDAQFXZGSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4OS/c1-12-16(24-11-20-12)18(23)22-9-6-13(7-10-22)15-5-4-14-3-2-8-19-17(14)21-15/h2-5,8,11,13H,6-7,9-10H2,1H3.
What are the key properties of (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone?
(4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone has a molecular weight of 338.44 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,3-thiazol-5-yl)-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone is sourced from PubChem (CID 155980501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).