C19H23N3O — CID 155941699
cyclopentyl-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone (PubChem CID 155941699) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is cyclopentyl-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone.
| Compound Name | cyclopentyl-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 155941699 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | cyclopentyl-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCC(c2ccc3cccnc3n2)CC1 |
| InChI | InChI=1S/C19H23N3O/c23-19(16-4-1-2-5-16)22-12-9-14(10-13-22)17-8-7-15-6-3-11-20-18(15)21-17/h3,6-8,11,14,16H,1-2,4-5,9-10,12-13H2 |
| InChIKey | RJFZFBHNNQYFPU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |