C18H30N4O3 — CID 146111282
[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(hydroxymethyl)-4-(propan-2-ylamino)piperidin-1-yl]methanone (PubChem CID 146111282) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(hydroxymethyl)-4-(propan-2-ylamino)piperidin-1-yl]methanone.
| Compound Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(hydroxymethyl)-4-(propan-2-ylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 146111282 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(hydroxymethyl)-4-(propan-2-ylamino)piperidin-1-yl]methanone |
| SMILES | CC(C)NC1(CO)CCN(C(=O)c2n[nH]c3c2C[C@H](C)O[C@@H]3C)CC1 |
| InChI | InChI=1S/C18H30N4O3/c1-11(2)19-18(10-23)5-7-22(8-6-18)17(24)16-14-9-12(3)25-13(4)15(14)20-21-16/h11-13,19,23H,5-10H2,1-4H3,(H,20,21)/t12-,13+/m0/s1 |
| InChIKey | NDPRCBJRGRZMOJ-QWHCGFSZSA-N |
| XLogP | 1.40 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |