C18H27N3O3 — CID 146115520
[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-(2-ethoxy-6-azaspiro[3.4]octan-6-yl)methanone (PubChem CID 146115520) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-(2-ethoxy-6-azaspiro[3.4]octan-6-yl)methanone.
| Compound Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-(2-ethoxy-6-azaspiro[3.4]octan-6-yl)methanone |
|---|---|
| PubChem CID | 146115520 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-(2-ethoxy-6-azaspiro[3.4]octan-6-yl)methanone |
| SMILES | CCOC1CC2(CCN(C(=O)c3n[nH]c4c3C[C@H](C)O[C@@H]4C)C2)C1 |
| InChI | InChI=1S/C18H27N3O3/c1-4-23-13-8-18(9-13)5-6-21(10-18)17(22)16-14-7-11(2)24-12(3)15(14)19-20-16/h11-13H,4-10H2,1-3H3,(H,19,20)/t11-,12+,13?,18?/m0/s1 |
| InChIKey | PCJGPJVXXYUHJW-PHYFXLJBSA-N |
| XLogP | 2.46 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |