C13H17F2N3O3 — CID 146111263
(2,2-difluoromorpholin-4-yl)-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]methanone (PubChem CID 146111263) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is (2,2-difluoromorpholin-4-yl)-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]methanone.
| Compound Name | (2,2-difluoromorpholin-4-yl)-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 146111263 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2,2-difluoromorpholin-4-yl)-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]methanone |
| SMILES | C[C@@H]1Cc2c(C(=O)N3CCOC(F)(F)C3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C13H17F2N3O3/c1-7-5-9-10(8(2)21-7)16-17-11(9)12(19)18-3-4-20-13(14,15)6-18/h7-8H,3-6H2,1-2H3,(H,16,17)/t7-,8+/m1/s1 |
| InChIKey | LNUZOIRYPFPGPU-SFYZADRCSA-N |
| XLogP | 1.50 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |