C14H19F2N3O3 — CID 146111593
(5R,7S)-N-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146111593) has the molecular formula C14H19F2N3O3 and a molecular weight of 315.32 g/mol. Its IUPAC name is (5R,7S)-N-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146111593 |
| Molecular Formula | C14H19F2N3O3 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (5R,7S)-N-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)NC3(CO)CC(F)(F)C3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C14H19F2N3O3/c1-7-3-9-10(8(2)22-7)18-19-11(9)12(21)17-13(6-20)4-14(15,16)5-13/h7-8,20H,3-6H2,1-2H3,(H,17,21)(H,18,19)/t7-,8+/m1/s1 |
| InChIKey | DWTHFFGBPAHJMX-SFYZADRCSA-N |
| XLogP | 1.32 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |