C16H23F2N3O3 — CID 146111365
(5R,7S)-N-[(4,4-difluoro-1-hydroxycyclohexyl)methyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146111365) has the molecular formula C16H23F2N3O3 and a molecular weight of 343.37 g/mol. Its IUPAC name is (5R,7S)-N-[(4,4-difluoro-1-hydroxycyclohexyl)methyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-[(4,4-difluoro-1-hydroxycyclohexyl)methyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146111365 |
| Molecular Formula | C16H23F2N3O3 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (5R,7S)-N-[(4,4-difluoro-1-hydroxycyclohexyl)methyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)NCC3(O)CCC(F)(F)CC3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C16H23F2N3O3/c1-9-7-11-12(10(2)24-9)20-21-13(11)14(22)19-8-15(23)3-5-16(17,18)6-4-15/h9-10,23H,3-8H2,1-2H3,(H,19,22)(H,20,21)/t9-,10+/m1/s1 |
| InChIKey | KFRZDCSHRNABMT-ZJUUUORDSA-N |
| XLogP | 2.10 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |