C21H28N4O2 — CID 146105033
[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 146105033) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 146105033 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1cccc(CN2CCN(C(=O)c3n[nH]c4c3C[C@@H](C)O[C@H]4C)CC2)c1 |
| InChI | InChI=1S/C21H28N4O2/c1-14-5-4-6-17(11-14)13-24-7-9-25(10-8-24)21(26)20-18-12-15(2)27-16(3)19(18)22-23-20/h4-6,11,15-16H,7-10,12-13H2,1-3H3,(H,22,23)/t15-,16+/m1/s1 |
| InChIKey | UQBKEGHMBHTGPY-CVEARBPZSA-N |
| XLogP | 2.70 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |