C22H28N4O3 — CID 146111275
1-benzyl-4-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-3,3-dimethylpiperazin-2-one (PubChem CID 146111275) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-benzyl-4-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 1-benzyl-4-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 146111275 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-benzyl-4-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-3,3-dimethylpiperazin-2-one |
| SMILES | C[C@@H]1Cc2c(C(=O)N3CCN(Cc4ccccc4)C(=O)C3(C)C)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C22H28N4O3/c1-14-12-17-18(15(2)29-14)23-24-19(17)20(27)26-11-10-25(21(28)22(26,3)4)13-16-8-6-5-7-9-16/h5-9,14-15H,10-13H2,1-4H3,(H,23,24)/t14-,15+/m1/s1 |
| InChIKey | RJRWWUXKBPWMRX-CABCVRRESA-N |
| XLogP | 2.70 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |