C17H24N6O2 — CID 167832385
[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(1H-pyrazol-4-ylmethyl)piperazin-1-yl]methanone (PubChem CID 167832385) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(1H-pyrazol-4-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(1H-pyrazol-4-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 167832385 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(1H-pyrazol-4-ylmethyl)piperazin-1-yl]methanone |
| SMILES | C[C@@H]1Cc2c(C(=O)N3CCN(Cc4cn[nH]c4)CC3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C17H24N6O2/c1-11-7-14-15(12(2)25-11)20-21-16(14)17(24)23-5-3-22(4-6-23)10-13-8-18-19-9-13/h8-9,11-12H,3-7,10H2,1-2H3,(H,18,19)(H,20,21)/t11-,12+/m1/s1 |
| InChIKey | BWXRLMKMIMASAR-NEPJUHHUSA-N |
| XLogP | 1.11 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |