C18H29N3O2 — CID 146102997
(5R,7S)-N-(4,4-dimethylcyclohexyl)-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146102997) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (5R,7S)-N-(4,4-dimethylcyclohexyl)-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-(4,4-dimethylcyclohexyl)-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146102997 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (5R,7S)-N-(4,4-dimethylcyclohexyl)-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)N(C)C3CCC(C)(C)CC3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C18H29N3O2/c1-11-10-14-15(12(2)23-11)19-20-16(14)17(22)21(5)13-6-8-18(3,4)9-7-13/h11-13H,6-10H2,1-5H3,(H,19,20)/t11-,12+/m1/s1 |
| InChIKey | XEIVREFVPZDHJP-NEPJUHHUSA-N |
| XLogP | 3.47 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |