C17H23N7O — CID 146103263
3-(5-aminotetrazol-1-yl)-N-(3-piperidin-1-ylcyclobutyl)benzamide (PubChem CID 146103263) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is 3-(5-aminotetrazol-1-yl)-N-(3-piperidin-1-ylcyclobutyl)benzamide.
| Compound Name | 3-(5-aminotetrazol-1-yl)-N-(3-piperidin-1-ylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 146103263 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 3-(5-aminotetrazol-1-yl)-N-(3-piperidin-1-ylcyclobutyl)benzamide |
| SMILES | Nc1nnnn1-c1cccc(C(=O)NC2CC(N3CCCCC3)C2)c1 |
| InChI | InChI=1S/C17H23N7O/c18-17-20-21-22-24(17)14-6-4-5-12(9-14)16(25)19-13-10-15(11-13)23-7-2-1-3-8-23/h4-6,9,13,15H,1-3,7-8,10-11H2,(H,19,25)(H2,18,20,22) |
| InChIKey | OWOCGYXNWXBOAN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |