C14H16F3N5O — CID 146103274
[2-(1-methylpyrazol-4-yl)piperidin-1-yl]-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone (PubChem CID 146103274) has the molecular formula C14H16F3N5O and a molecular weight of 327.31 g/mol. Its IUPAC name is [2-(1-methylpyrazol-4-yl)piperidin-1-yl]-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone.
| Compound Name | [2-(1-methylpyrazol-4-yl)piperidin-1-yl]-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 146103274 |
| Molecular Formula | C14H16F3N5O |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [2-(1-methylpyrazol-4-yl)piperidin-1-yl]-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone |
| SMILES | Cn1cc(C2CCCCN2C(=O)c2cc(C(F)(F)F)[nH]n2)cn1 |
| InChI | InChI=1S/C14H16F3N5O/c1-21-8-9(7-18-21)11-4-2-3-5-22(11)13(23)10-6-12(20-19-10)14(15,16)17/h6-8,11H,2-5H2,1H3,(H,19,20) |
| InChIKey | KMLRHSBEXAVLIZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |