C8H11ClF2N2O2 — CID 146103283
2-chloro-N-[(5,5-difluoro-6-oxopiperidin-2-yl)methyl]acetamide (PubChem CID 146103283) has the molecular formula C8H11ClF2N2O2 and a molecular weight of 240.64 g/mol. Its IUPAC name is 2-chloro-N-[(5,5-difluoro-6-oxopiperidin-2-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(5,5-difluoro-6-oxopiperidin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 146103283 |
| Molecular Formula | C8H11ClF2N2O2 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-chloro-N-[(5,5-difluoro-6-oxopiperidin-2-yl)methyl]acetamide |
| SMILES | O=C(CCl)NCC1CCC(F)(F)C(=O)N1 |
| InChI | InChI=1S/C8H11ClF2N2O2/c9-3-6(14)12-4-5-1-2-8(10,11)7(15)13-5/h5H,1-4H2,(H,12,14)(H,13,15) |
| InChIKey | MIFSHUCLQLREGX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|