C12H17F2NO2 — CID 146103811
N-[[4-(1,1-difluoroethyl)oxan-4-yl]methyl]but-2-ynamide (PubChem CID 146103811) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is N-[[4-(1,1-difluoroethyl)oxan-4-yl]methyl]but-2-ynamide.
| Compound Name | N-[[4-(1,1-difluoroethyl)oxan-4-yl]methyl]but-2-ynamide |
|---|---|
| PubChem CID | 146103811 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-[[4-(1,1-difluoroethyl)oxan-4-yl]methyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCC1(C(C)(F)F)CCOCC1 |
| InChI | InChI=1S/C12H17F2NO2/c1-3-4-10(16)15-9-12(11(2,13)14)5-7-17-8-6-12/h5-9H2,1-2H3,(H,15,16) |
| InChIKey | DCJWFUIEAPRHKI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|