C12H19NO2 — CID 146088479
N-[(1-ethoxycyclopentyl)methyl]but-2-ynamide (PubChem CID 146088479) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(1-ethoxycyclopentyl)methyl]but-2-ynamide.
| Compound Name | N-[(1-ethoxycyclopentyl)methyl]but-2-ynamide |
|---|---|
| PubChem CID | 146088479 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-[(1-ethoxycyclopentyl)methyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCC1(OCC)CCCC1 |
| InChI | InChI=1S/C12H19NO2/c1-3-7-11(14)13-10-12(15-4-2)8-5-6-9-12/h4-6,8-10H2,1-2H3,(H,13,14) |
| InChIKey | SPZOKQMDQLNMSC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|