C11H21NO4 — CID 103993337
N-[(1-methoxycyclobutyl)methyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 103993337) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is N-[(1-methoxycyclobutyl)methyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[(1-methoxycyclobutyl)methyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 103993337 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N-[(1-methoxycyclobutyl)methyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NCC1(OC)CCC1 |
| InChI | InChI=1S/C11H21NO4/c1-14-6-7-16-8-10(13)12-9-11(15-2)4-3-5-11/h3-9H2,1-2H3,(H,12,13) |
| InChIKey | CPSZDSGERSCJCN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|