C19H25N3O4 — CID 146104981
(5S,7R)-N-[(3,4-dimethoxyphenyl)methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146104981) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (5S,7R)-N-[(3,4-dimethoxyphenyl)methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5S,7R)-N-[(3,4-dimethoxyphenyl)methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146104981 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (5S,7R)-N-[(3,4-dimethoxyphenyl)methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | COc1ccc(CN(C)C(=O)c2n[nH]c3c2C[C@H](C)O[C@@H]3C)cc1OC |
| InChI | InChI=1S/C19H25N3O4/c1-11-8-14-17(12(2)26-11)20-21-18(14)19(23)22(3)10-13-6-7-15(24-4)16(9-13)25-5/h6-7,9,11-12H,8,10H2,1-5H3,(H,20,21)/t11-,12+/m0/s1 |
| InChIKey | MQBXOZZGZRNVLR-NWDGAFQWSA-N |
| XLogP | 2.72 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |