C21H30N4O3 — CID 146115299
(5R,7S)-N-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146115299) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is (5R,7S)-N-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146115299 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (5R,7S)-N-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)N(C)Cc3cccc(OCCN(C)C)c3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C21H30N4O3/c1-14-11-18-19(15(2)28-14)22-23-20(18)21(26)25(5)13-16-7-6-8-17(12-16)27-10-9-24(3)4/h6-8,12,14-15H,9-11,13H2,1-5H3,(H,22,23)/t14-,15+/m1/s1 |
| InChIKey | FLLGXKIRMUBAOQ-CABCVRRESA-N |
| XLogP | 2.64 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |