C19H22N6O2 — CID 146115454
(5R,7S)-N-benzyl-5,7-dimethyl-N-(2H-triazol-4-ylmethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146115454) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is (5R,7S)-N-benzyl-5,7-dimethyl-N-(2H-triazol-4-ylmethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-benzyl-5,7-dimethyl-N-(2H-triazol-4-ylmethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146115454 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (5R,7S)-N-benzyl-5,7-dimethyl-N-(2H-triazol-4-ylmethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)N(Cc3ccccc3)Cc3cn[nH]n3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C19H22N6O2/c1-12-8-16-17(13(2)27-12)22-23-18(16)19(26)25(11-15-9-20-24-21-15)10-14-6-4-3-5-7-14/h3-7,9,12-13H,8,10-11H2,1-2H3,(H,22,23)(H,20,21,24)/t12-,13+/m1/s1 |
| InChIKey | FTENRCXXYZZDQV-OLZOCXBDSA-N |
| XLogP | 2.39 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |