C17H24N4O2 — CID 146102982
(5S,7R)-N-[(1-ethylpyrrol-2-yl)methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146102982) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is (5S,7R)-N-[(1-ethylpyrrol-2-yl)methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5S,7R)-N-[(1-ethylpyrrol-2-yl)methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146102982 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (5S,7R)-N-[(1-ethylpyrrol-2-yl)methyl]-N,5,7-trimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | CCn1cccc1CN(C)C(=O)c1n[nH]c2c1C[C@H](C)O[C@@H]2C |
| InChI | InChI=1S/C17H24N4O2/c1-5-21-8-6-7-13(21)10-20(4)17(22)16-14-9-11(2)23-12(3)15(14)18-19-16/h6-8,11-12H,5,9-10H2,1-4H3,(H,18,19)/t11-,12+/m0/s1 |
| InChIKey | MGYXGKYMIWCPNB-NWDGAFQWSA-N |
| XLogP | 2.53 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |