C9H11ClN2O3 — CID 146105310
2-chloro-N-[(4-methoxy-2-oxo-1H-pyridin-3-yl)methyl]acetamide (PubChem CID 146105310) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is 2-chloro-N-[(4-methoxy-2-oxo-1H-pyridin-3-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(4-methoxy-2-oxo-1H-pyridin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 146105310 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-chloro-N-[(4-methoxy-2-oxo-1H-pyridin-3-yl)methyl]acetamide |
| SMILES | COc1cc[nH]c(=O)c1CNC(=O)CCl |
| InChI | InChI=1S/C9H11ClN2O3/c1-15-7-2-3-11-9(14)6(7)5-12-8(13)4-10/h2-3H,4-5H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | VOAKEXFBDYQKDA-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|