C16H23N5O3 — CID 146108202
1-[9-[3,3-bis(hydroxymethyl)cyclobutyl]purin-6-yl]piperidin-3-ol (PubChem CID 146108202) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-[9-[3,3-bis(hydroxymethyl)cyclobutyl]purin-6-yl]piperidin-3-ol.
| Compound Name | 1-[9-[3,3-bis(hydroxymethyl)cyclobutyl]purin-6-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 146108202 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-[9-[3,3-bis(hydroxymethyl)cyclobutyl]purin-6-yl]piperidin-3-ol |
| SMILES | OCC1(CO)CC(n2cnc3c(N4CCCC(O)C4)ncnc32)C1 |
| InChI | InChI=1S/C16H23N5O3/c22-7-16(8-23)4-11(5-16)21-10-19-13-14(17-9-18-15(13)21)20-3-1-2-12(24)6-20/h9-12,22-24H,1-8H2 |
| InChIKey | VOBRMWBLVLISDN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |