C15H18N2O3 — CID 146109464
(3aS,6aR)-5-[(3-methoxy-2-methylphenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione (PubChem CID 146109464) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (3aS,6aR)-5-[(3-methoxy-2-methylphenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione.
| Compound Name | (3aS,6aR)-5-[(3-methoxy-2-methylphenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 146109464 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (3aS,6aR)-5-[(3-methoxy-2-methylphenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
| SMILES | COc1cccc(CN2C[C@@H]3C(=O)NC(=O)[C@@H]3C2)c1C |
| InChI | InChI=1S/C15H18N2O3/c1-9-10(4-3-5-13(9)20-2)6-17-7-11-12(8-17)15(19)16-14(11)18/h3-5,11-12H,6-8H2,1-2H3,(H,16,18,19)/t11-,12+ |
| InChIKey | PKRWEUURGWZOMO-TXEJJXNPSA-N |
| XLogP | 0.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|