C19H20N4O2 — CID 146111491
2-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-3,4-dihydro-1H-isoquinoline-6-carbonitrile (PubChem CID 146111491) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-3,4-dihydro-1H-isoquinoline-6-carbonitrile.
| Compound Name | 2-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-3,4-dihydro-1H-isoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 146111491 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-3,4-dihydro-1H-isoquinoline-6-carbonitrile |
| SMILES | C[C@@H]1Cc2c(C(=O)N3CCc4cc(C#N)ccc4C3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C19H20N4O2/c1-11-7-16-17(12(2)25-11)21-22-18(16)19(24)23-6-5-14-8-13(9-20)3-4-15(14)10-23/h3-4,8,11-12H,5-7,10H2,1-2H3,(H,21,22)/t11-,12+/m1/s1 |
| InChIKey | YXJMEYYSSVYYDF-NEPJUHHUSA-N |
| XLogP | 2.50 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |