C16H20F3N5O2 — CID 146111581
(5R,7S)-5,7-dimethyl-N-[3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]propyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146111581) has the molecular formula C16H20F3N5O2 and a molecular weight of 371.36 g/mol. Its IUPAC name is (5R,7S)-5,7-dimethyl-N-[3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]propyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-5,7-dimethyl-N-[3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]propyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146111581 |
| Molecular Formula | C16H20F3N5O2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (5R,7S)-5,7-dimethyl-N-[3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]propyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)NCCCc3cn[nH]c3C(F)(F)F)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C16H20F3N5O2/c1-8-6-11-12(9(2)26-8)22-23-13(11)15(25)20-5-3-4-10-7-21-24-14(10)16(17,18)19/h7-9H,3-6H2,1-2H3,(H,20,25)(H,21,24)(H,22,23)/t8-,9+/m1/s1 |
| InChIKey | XPVZWJDFGCTHHY-BDAKNGLRSA-N |
| XLogP | 2.54 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|