About 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide
2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide (PubChem CID 146113441) has the molecular formula C14H20N6O2
and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide |
| PubChem CID | 146113441 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide |
| SMILES | CO[C@@H]1CN(c2ccnc(N(C)C)n2)C[C@@H]1NC(=O)CC#N |
| InChI | InChI=1S/C14H20N6O2/c1-19(2)14-16-7-5-12(18-14)20-8-10(11(9-20)22-3)17-13(21)4-6-15/h5,7,10-11H,4,8-9H2,1-3H3,(H,17,21)/t10-,11+/m0/s1 |
| InChIKey | SKDANDIFCPNNJR-WDEREUQCSA-N |
| XLogP | -0.22 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide?
The IUPAC name of 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide (CID 146113441) is 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide.
What is the SMILES notation for 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide?
The canonical SMILES for 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide is CO[C@@H]1CN(c2ccnc(N(C)C)n2)C[C@@H]1NC(=O)CC#N.
What is the InChIKey of 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide?
The InChIKey is SKDANDIFCPNNJR-WDEREUQCSA-N. The full InChI is InChI=1S/C14H20N6O2/c1-19(2)14-16-7-5-12(18-14)20-8-10(11(9-20)22-3)17-13(21)4-6-15/h5,7,10-11H,4,8-9H2,1-3H3,(H,17,21)/t10-,11+/m0/s1.
What are the key properties of 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide?
2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide has a molecular weight of 304.35 g/mol, XLogP of -0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(3S,4R)-1-[2-(dimethylamino)pyrimidin-4-yl]-4-methoxypyrrolidin-3-yl]acetamide is sourced from PubChem (CID 146113441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).