C19H22N6O2 — CID 146113494
(5R,7S)-1,5,7-trimethyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146113494) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is (5R,7S)-1,5,7-trimethyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-1,5,7-trimethyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146113494 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (5R,7S)-1,5,7-trimethyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)NCc3nncn3-c3ccccc3)nn(C)c2[C@H](C)O1 |
| InChI | InChI=1S/C19H22N6O2/c1-12-9-15-17(23-24(3)18(15)13(2)27-12)19(26)20-10-16-22-21-11-25(16)14-7-5-4-6-8-14/h4-8,11-13H,9-10H2,1-3H3,(H,20,26)/t12-,13+/m1/s1 |
| InChIKey | HWKOXTRSVOPWHG-OLZOCXBDSA-N |
| XLogP | 1.95 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |