C20H26N4O3 — CID 146101233
(5S,7R)-1,5,7-trimethyl-N-[2-[3-(methylcarbamoyl)phenyl]ethyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146101233) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is (5S,7R)-1,5,7-trimethyl-N-[2-[3-(methylcarbamoyl)phenyl]ethyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5S,7R)-1,5,7-trimethyl-N-[2-[3-(methylcarbamoyl)phenyl]ethyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146101233 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (5S,7R)-1,5,7-trimethyl-N-[2-[3-(methylcarbamoyl)phenyl]ethyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | CNC(=O)c1cccc(CCNC(=O)c2nn(C)c3c2C[C@H](C)O[C@@H]3C)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-12-10-16-17(23-24(4)18(16)13(2)27-12)20(26)22-9-8-14-6-5-7-15(11-14)19(25)21-3/h5-7,11-13H,8-10H2,1-4H3,(H,21,25)(H,22,26)/t12-,13+/m0/s1 |
| InChIKey | XZSAGGXQTHZGQV-QWHCGFSZSA-N |
| XLogP | 1.77 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |