C18H21N3O3S — CID 146114578
(9-imino-9-oxo-1-oxa-9λ6-thia-4-azaspiro[5.5]undecan-4-yl)-isoquinolin-7-ylmethanone (PubChem CID 146114578) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is (9-imino-9-oxo-1-oxa-9λ6-thia-4-azaspiro[5.5]undecan-4-yl)-isoquinolin-7-ylmethanone.
| Compound Name | (9-imino-9-oxo-1-oxa-9λ6-thia-4-azaspiro[5.5]undecan-4-yl)-isoquinolin-7-ylmethanone |
|---|---|
| PubChem CID | 146114578 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (9-imino-9-oxo-1-oxa-9λ6-thia-4-azaspiro[5.5]undecan-4-yl)-isoquinolin-7-ylmethanone |
| SMILES | [H]N=S1(=O)CCC2(CC1)CN(C(=O)c1ccc3ccncc3c1)CCO2 |
| InChI | InChI=1S/C18H21N3O3S/c19-25(23)9-4-18(5-10-25)13-21(7-8-24-18)17(22)15-2-1-14-3-6-20-12-16(14)11-15/h1-3,6,11-12,19H,4-5,7-10,13H2 |
| InChIKey | FLIDQQWRGVFHRI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |