C35H44FN7O7 — CID 146116507
4-fluoro-N-[2-[(16R,17R)-2,5,14-trioxo-17-[2-[4-(phenoxymethyl)triazol-1-yl]ethyl]-7,10-dioxa-1,4,13-triazabicyclo[14.2.2]icosan-4-yl]ethyl]benzamide (PubChem CID 146116507) has the molecular formula C35H44FN7O7 and a molecular weight of 693.78 g/mol. Its IUPAC name is 4-fluoro-N-[2-[(16R,17R)-2,5,14-trioxo-17-[2-[4-(phenoxymethyl)triazol-1-yl]ethyl]-7,10-dioxa-1,4,13-triazabicyclo[14.2.2]icosan-4-yl]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[(16R,17R)-2,5,14-trioxo-17-[2-[4-(phenoxymethyl)triazol-1-yl]ethyl]-7,10-dioxa-1,4,13-triazabicyclo[14.2.2]icosan-4-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 146116507 |
| Molecular Formula | C35H44FN7O7 |
| Molecular Weight | 693.78 g/mol |
| Exact Mass | 693.33 |
| IUPAC Name | 4-fluoro-N-[2-[(16R,17R)-2,5,14-trioxo-17-[2-[4-(phenoxymethyl)triazol-1-yl]ethyl]-7,10-dioxa-1,4,13-triazabicyclo[14.2.2]icosan-4-yl]ethyl]benzamide |
| SMILES | O=C1C[C@H]2CCN(C[C@@H]2CCn2cc(COc3ccccc3)nn2)C(=O)CN(CCNC(=O)c2ccc(F)cc2)C(=O)COCCOCCN1 |
| InChI | InChI=1S/C35H44FN7O7/c36-29-8-6-26(7-9-29)35(47)38-12-16-42-23-33(45)41-14-10-27(20-32(44)37-13-17-48-18-19-49-25-34(42)46)28(21-41)11-15-43-22-30(39-40-43)24-50-31-4-2-1-3-5-31/h1-9,22,27-28H,10-21,23-25H2,(H,37,44)(H,38,47)/t27-,28+/m1/s1 |
| InChIKey | XTIOOTNOSQOGCL-IZLXSDGUSA-N |
| XLogP | 1.66 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.78 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|