C15H27N3O2 — CID 146118387
(3aS,4R,5S,6aR)-4-(aminomethyl)-5-methyl-1-(2-morpholin-4-ylethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-2-one (PubChem CID 146118387) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is (3aS,4R,5S,6aR)-4-(aminomethyl)-5-methyl-1-(2-morpholin-4-ylethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-2-one.
| Compound Name | (3aS,4R,5S,6aR)-4-(aminomethyl)-5-methyl-1-(2-morpholin-4-ylethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-2-one |
|---|---|
| PubChem CID | 146118387 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (3aS,4R,5S,6aR)-4-(aminomethyl)-5-methyl-1-(2-morpholin-4-ylethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-2-one |
| SMILES | C[C@H]1C[C@@H]2[C@@H](CC(=O)N2CCN2CCOCC2)[C@@H]1CN |
| InChI | InChI=1S/C15H27N3O2/c1-11-8-14-12(13(11)10-16)9-15(19)18(14)3-2-17-4-6-20-7-5-17/h11-14H,2-10,16H2,1H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | CLUBTTMIXKTVHN-IGQOVBAYSA-N |
| XLogP | 0.15 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |