About O-[(E)-but-2-enyl] benzylsulfanylmethanethioate
O-[(E)-but-2-enyl] benzylsulfanylmethanethioate (PubChem CID 14611946) has the molecular formula C12H14OS2
and a molecular weight of 238.38 g/mol. Its IUPAC name is O-[(E)-but-2-enyl] benzylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-[(E)-but-2-enyl] benzylsulfanylmethanethioate |
| PubChem CID | 14611946 |
| Molecular Formula | C12H14OS2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | O-[(E)-but-2-enyl] benzylsulfanylmethanethioate |
| SMILES | C/C=C/COC(=S)SCc1ccccc1 |
| InChI | InChI=1S/C12H14OS2/c1-2-3-9-13-12(14)15-10-11-7-5-4-6-8-11/h2-8H,9-10H2,1H3/b3-2+ |
| InChIKey | CYOSOFDJODSLKQ-NSCUHMNNSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[(E)-but-2-enyl] benzylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(E)-but-2-enyl] benzylsulfanylmethanethioate?
The IUPAC name of O-[(E)-but-2-enyl] benzylsulfanylmethanethioate (CID 14611946) is O-[(E)-but-2-enyl] benzylsulfanylmethanethioate.
What is the SMILES notation for O-[(E)-but-2-enyl] benzylsulfanylmethanethioate?
The canonical SMILES for O-[(E)-but-2-enyl] benzylsulfanylmethanethioate is C/C=C/COC(=S)SCc1ccccc1.
What is the InChIKey of O-[(E)-but-2-enyl] benzylsulfanylmethanethioate?
The InChIKey is CYOSOFDJODSLKQ-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H14OS2/c1-2-3-9-13-12(14)15-10-11-7-5-4-6-8-11/h2-8H,9-10H2,1H3/b3-2+.
What are the key properties of O-[(E)-but-2-enyl] benzylsulfanylmethanethioate?
O-[(E)-but-2-enyl] benzylsulfanylmethanethioate has a molecular weight of 238.38 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(E)-but-2-enyl] benzylsulfanylmethanethioate is sourced from PubChem (CID 14611946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).