C14H15BrS — CID 129044201
[(3Z,5E)-5-bromohepta-1,3,5-trien-2-yl]sulfanylmethylbenzene (PubChem CID 129044201) has the molecular formula C14H15BrS and a molecular weight of 295.25 g/mol. Its IUPAC name is [(3Z,5E)-5-bromohepta-1,3,5-trien-2-yl]sulfanylmethylbenzene.
| Compound Name | [(3Z,5E)-5-bromohepta-1,3,5-trien-2-yl]sulfanylmethylbenzene |
|---|---|
| PubChem CID | 129044201 |
| Molecular Formula | C14H15BrS |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | [(3Z,5E)-5-bromohepta-1,3,5-trien-2-yl]sulfanylmethylbenzene |
| SMILES | C=C(/C=C\C(Br)=C/C)SCc1ccccc1 |
| InChI | InChI=1S/C14H15BrS/c1-3-14(15)10-9-12(2)16-11-13-7-5-4-6-8-13/h3-10H,2,11H2,1H3/b10-9-,14-3+ |
| InChIKey | JEYACJQBIATMPC-JXPHJQCQSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|