About benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione
benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione (PubChem CID 166968854) has the molecular formula C17H20S3
and a molecular weight of 320.55 g/mol. Its IUPAC name is benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione.
Molecular Properties
| Compound Name | benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione |
| PubChem CID | 166968854 |
| Molecular Formula | C17H20S3 |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione |
| SMILES | C=C(/C=C\C=C/CC)CSC(=S)SCc1ccccc1 |
| InChI | InChI=1S/C17H20S3/c1-3-4-5-7-10-15(2)13-19-17(18)20-14-16-11-8-6-9-12-16/h4-12H,2-3,13-14H2,1H3/b5-4-,10-7- |
| InChIKey | DMYGFMSCHNFZRY-WKBXPBOGSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione?
The IUPAC name of benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione (CID 166968854) is benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione.
What is the SMILES notation for benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione?
The canonical SMILES for benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione is C=C(/C=C\C=C/CC)CSC(=S)SCc1ccccc1.
What is the InChIKey of benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione?
The InChIKey is DMYGFMSCHNFZRY-WKBXPBOGSA-N. The full InChI is InChI=1S/C17H20S3/c1-3-4-5-7-10-15(2)13-19-17(18)20-14-16-11-8-6-9-12-16/h4-12H,2-3,13-14H2,1H3/b5-4-,10-7-.
What are the key properties of benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione?
benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione has a molecular weight of 320.55 g/mol, XLogP of 6.02, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione is sourced from PubChem (CID 166968854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).