C17H20S3 — CID 166968854
benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione (PubChem CID 166968854) has the molecular formula C17H20S3 and a molecular weight of 320.55 g/mol. Its IUPAC name is benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione.
| Compound Name | benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione |
|---|---|
| PubChem CID | 166968854 |
| Molecular Formula | C17H20S3 |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | benzylsulfanyl-[(3Z,5Z)-2-methylideneocta-3,5-dienyl]sulfanylmethanethione |
| SMILES | C=C(/C=C\C=C/CC)CSC(=S)SCc1ccccc1 |
| InChI | InChI=1S/C17H20S3/c1-3-4-5-7-10-15(2)13-19-17(18)20-14-16-11-8-6-9-12-16/h4-12H,2-3,13-14H2,1H3/b5-4-,10-7- |
| InChIKey | DMYGFMSCHNFZRY-WKBXPBOGSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|