C23H28N2 — CID 142118466
(3Z,5Z)-N-[(E)-1-(4-ethenyl-1-phenyl-2,5-dihydropyrrol-3-yl)prop-1-en-2-yl]octa-1,3,5-trien-2-amine (PubChem CID 142118466) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (3Z,5Z)-N-[(E)-1-(4-ethenyl-1-phenyl-2,5-dihydropyrrol-3-yl)prop-1-en-2-yl]octa-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-N-[(E)-1-(4-ethenyl-1-phenyl-2,5-dihydropyrrol-3-yl)prop-1-en-2-yl]octa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 142118466 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | (3Z,5Z)-N-[(E)-1-(4-ethenyl-1-phenyl-2,5-dihydropyrrol-3-yl)prop-1-en-2-yl]octa-1,3,5-trien-2-amine |
| SMILES | C=CC1=C(/C=C(\C)NC(=C)/C=C\C=C/CC)CN(c2ccccc2)C1 |
| InChI | InChI=1S/C23H28N2/c1-5-7-8-10-13-19(3)24-20(4)16-22-18-25(17-21(22)6-2)23-14-11-9-12-15-23/h6-16,24H,2-3,5,17-18H2,1,4H3/b8-7-,13-10-,20-16+ |
| InChIKey | ANSDSLLCPVBFNB-HCYBEICKSA-N |
| XLogP | 5.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|