C16H18N2 — CID 89067951
1-methyl-2-[(3Z,5Z)-octa-1,3,5-trien-2-yl]benzimidazole (PubChem CID 89067951) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-methyl-2-[(3Z,5Z)-octa-1,3,5-trien-2-yl]benzimidazole.
| Compound Name | 1-methyl-2-[(3Z,5Z)-octa-1,3,5-trien-2-yl]benzimidazole |
|---|---|
| PubChem CID | 89067951 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-methyl-2-[(3Z,5Z)-octa-1,3,5-trien-2-yl]benzimidazole |
| SMILES | C=C(/C=C\C=C/CC)c1nc2ccccc2n1C |
| InChI | InChI=1S/C16H18N2/c1-4-5-6-7-10-13(2)16-17-14-11-8-9-12-15(14)18(16)3/h5-12H,2,4H2,1,3H3/b6-5-,10-7- |
| InChIKey | AWZANZGJPBMVPK-ICZHLNMZSA-N |
| XLogP | 4.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|