C15H14N2 — CID 90999515
2-hepta-2,4-dien-6-yn-3-yl-1-methylbenzimidazole (PubChem CID 90999515) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-hepta-2,4-dien-6-yn-3-yl-1-methylbenzimidazole.
| Compound Name | 2-hepta-2,4-dien-6-yn-3-yl-1-methylbenzimidazole |
|---|---|
| PubChem CID | 90999515 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-hepta-2,4-dien-6-yn-3-yl-1-methylbenzimidazole |
| SMILES | C#CC=CC(=CC)c1nc2ccccc2n1C |
| InChI | InChI=1S/C15H14N2/c1-4-6-9-12(5-2)15-16-13-10-7-8-11-14(13)17(15)3/h1,5-11H,2-3H3 |
| InChIKey | ORUVKQGHHDUMOJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|