C20H25S+ — CID 143451215
[(2E,4Z)-hepta-2,4-dien-2-yl]-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-phenylsulfanium (PubChem CID 143451215) has the molecular formula C20H25S+ and a molecular weight of 297.49 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4-dien-2-yl]-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-phenylsulfanium.
| Compound Name | [(2E,4Z)-hepta-2,4-dien-2-yl]-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-phenylsulfanium |
|---|---|
| PubChem CID | 143451215 |
| Molecular Formula | C20H25S+ |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [(2E,4Z)-hepta-2,4-dien-2-yl]-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-phenylsulfanium |
| SMILES | C=C(C)/C=C\C(=C)[S+](/C(C)=C/C=C\CC)c1ccccc1 |
| InChI | InChI=1S/C20H25S/c1-6-7-9-12-18(4)21(19(5)16-15-17(2)3)20-13-10-8-11-14-20/h7-16H,2,5-6H2,1,3-4H3/q+1/b9-7-,16-15-,18-12+ |
| InChIKey | DTEIBXYZIUXBJW-FNAPMLIDSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|