C20H31BrN2 — CID 145377488
(4E,6Z)-N-benzyl-2-bromo-4-methylnona-4,6-dien-3-imine;ethane;methanimine (PubChem CID 145377488) has the molecular formula C20H31BrN2 and a molecular weight of 379.39 g/mol. Its IUPAC name is (4E,6Z)-N-benzyl-2-bromo-4-methylnona-4,6-dien-3-imine;ethane;methanimine.
| Compound Name | (4E,6Z)-N-benzyl-2-bromo-4-methylnona-4,6-dien-3-imine;ethane;methanimine |
|---|---|
| PubChem CID | 145377488 |
| Molecular Formula | C20H31BrN2 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (4E,6Z)-N-benzyl-2-bromo-4-methylnona-4,6-dien-3-imine;ethane;methanimine |
| SMILES | CC.CC/C=C\C=C(C)\C(=N\Cc1ccccc1)C(C)Br.[H]N=C |
| InChI | InChI=1S/C17H22BrN.C2H6.CH3N/c1-4-5-7-10-14(2)17(15(3)18)19-13-16-11-8-6-9-12-16;2*1-2/h5-12,15H,4,13H2,1-3H3;1-2H3;2H,1H2/b7-5-,14-10+,19-17-;; |
| InChIKey | OSVJKJPVSWVAQN-KDDUFXBTSA-N |
| XLogP | 6.62 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|