C20H26FS+ — CID 142377180
ethane;[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylsulfanium (PubChem CID 142377180) has the molecular formula C20H26FS+ and a molecular weight of 317.49 g/mol. Its IUPAC name is ethane;[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylsulfanium.
| Compound Name | ethane;[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylsulfanium |
|---|---|
| PubChem CID | 142377180 |
| Molecular Formula | C20H26FS+ |
| Molecular Weight | 317.49 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | ethane;[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylsulfanium |
| SMILES | C=C(F)/C=C\C(=C)[S+](/C(C)=C/C=C\C)c1ccccc1.CC |
| InChI | InChI=1S/C18H20FS.C2H6/c1-5-6-10-16(3)20(17(4)14-13-15(2)19)18-11-8-7-9-12-18;1-2/h5-14H,2,4H2,1,3H3;1-2H3/q+1;/b6-5-,14-13-,16-10+; |
| InChIKey | YTAGRLLVXMIONK-LRRHWMPJSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.49 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|