C12H17NS — CID 16726576
2-benzylsulfanyl-N,N-dimethylprop-2-en-1-amine (PubChem CID 16726576) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 2-benzylsulfanyl-N,N-dimethylprop-2-en-1-amine.
| Compound Name | 2-benzylsulfanyl-N,N-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 16726576 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-benzylsulfanyl-N,N-dimethylprop-2-en-1-amine |
| SMILES | C=C(CN(C)C)SCc1ccccc1 |
| InChI | InChI=1S/C12H17NS/c1-11(9-13(2)3)14-10-12-7-5-4-6-8-12/h4-8H,1,9-10H2,2-3H3 |
| InChIKey | IQCZRNAUWRRQFK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |