C19H21NOS2 — CID 57114251
N,N-bis(benzylsulfanylmethyl)prop-2-enamide (PubChem CID 57114251) has the molecular formula C19H21NOS2 and a molecular weight of 343.52 g/mol. Its IUPAC name is N,N-bis(benzylsulfanylmethyl)prop-2-enamide.
| Compound Name | N,N-bis(benzylsulfanylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 57114251 |
| Molecular Formula | C19H21NOS2 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N,N-bis(benzylsulfanylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CSCc1ccccc1)CSCc1ccccc1 |
| InChI | InChI=1S/C19H21NOS2/c1-2-19(21)20(15-22-13-17-9-5-3-6-10-17)16-23-14-18-11-7-4-8-12-18/h2-12H,1,13-16H2 |
| InChIKey | BWAFPKDANMZUNX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|