C16H23N3O3 — CID 146119848
(3S,3aS,6aS)-3-(cyclopropylmethoxy)-1-methyl-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrol-2-one (PubChem CID 146119848) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-(cyclopropylmethoxy)-1-methyl-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrol-2-one.
| Compound Name | (3S,3aS,6aS)-3-(cyclopropylmethoxy)-1-methyl-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 146119848 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (3S,3aS,6aS)-3-(cyclopropylmethoxy)-1-methyl-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrol-2-one |
| SMILES | Cc1cc(CN2C[C@@H]3[C@H](OCC4CC4)C(=O)N(C)[C@@H]3C2)no1 |
| InChI | InChI=1S/C16H23N3O3/c1-10-5-12(17-22-10)6-19-7-13-14(8-19)18(2)16(20)15(13)21-9-11-3-4-11/h5,11,13-15H,3-4,6-9H2,1-2H3/t13-,14+,15-/m0/s1 |
| InChIKey | WHHJOYCNBLTECF-ZNMIVQPWSA-N |
| XLogP | 1.05 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |