C15H18N2O5S — CID 146121429
4-[1-(4-methoxyphenyl)propylsulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 146121429) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 4-[1-(4-methoxyphenyl)propylsulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[1-(4-methoxyphenyl)propylsulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 146121429 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-[1-(4-methoxyphenyl)propylsulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CCC(NS(=O)(=O)c1c[nH]c(C(=O)O)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H18N2O5S/c1-3-13(10-4-6-11(22-2)7-5-10)17-23(20,21)12-8-14(15(18)19)16-9-12/h4-9,13,16-17H,3H2,1-2H3,(H,18,19) |
| InChIKey | AABVKEGBTSTGJB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |