About cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid
cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 146121724) has the molecular formula C18H19N3O3
and a molecular weight of 325.37 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 146121724 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCC[C@H](C(=O)Nc2cnc(-c3ccccc3)nc2)C1 |
| InChI | InChI=1S/C18H19N3O3/c22-17(13-7-4-8-14(9-13)18(23)24)21-15-10-19-16(20-11-15)12-5-2-1-3-6-12/h1-3,5-6,10-11,13-14H,4,7-9H2,(H,21,22)(H,23,24)/t13-,14+/m0/s1 |
| InChIKey | ILGAVRWKNRXOSO-UONOGXRCSA-N |
| XLogP | 2.97 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid?
The IUPAC name of cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid (CID 146121724) is cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid is O=C(O)[C@@H]1CCC[C@H](C(=O)Nc2cnc(-c3ccccc3)nc2)C1.
What is the InChIKey of cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid?
The InChIKey is ILGAVRWKNRXOSO-UONOGXRCSA-N. The full InChI is InChI=1S/C18H19N3O3/c22-17(13-7-4-8-14(9-13)18(23)24)21-15-10-19-16(20-11-15)12-5-2-1-3-6-12/h1-3,5-6,10-11,13-14H,4,7-9H2,(H,21,22)(H,23,24)/t13-,14+/m0/s1.
What are the key properties of cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid?
cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid has a molecular weight of 325.37 g/mol, XLogP of 2.97, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-3-[(2-phenylpyrimidin-5-yl)carbamoyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 146121724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).