C8H16N2 — CID 14612244
2-ethenyl-1,4-dimethylpiperazine (PubChem CID 14612244) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-ethenyl-1,4-dimethylpiperazine.
| Compound Name | 2-ethenyl-1,4-dimethylpiperazine |
|---|---|
| PubChem CID | 14612244 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2-ethenyl-1,4-dimethylpiperazine |
| SMILES | C=CC1CN(C)CCN1C |
| InChI | InChI=1S/C8H16N2/c1-4-8-7-9(2)5-6-10(8)3/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | JUKXAYLMPOWYMF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|