C10H14ClN3O3S — CID 146122745
2-amino-5-chloro-N-(3-methyloxolan-3-yl)pyridine-3-sulfonamide (PubChem CID 146122745) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-amino-5-chloro-N-(3-methyloxolan-3-yl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-chloro-N-(3-methyloxolan-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 146122745 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-amino-5-chloro-N-(3-methyloxolan-3-yl)pyridine-3-sulfonamide |
| SMILES | CC1(NS(=O)(=O)c2cc(Cl)cnc2N)CCOC1 |
| InChI | InChI=1S/C10H14ClN3O3S/c1-10(2-3-17-6-10)14-18(15,16)8-4-7(11)5-13-9(8)12/h4-5,14H,2-3,6H2,1H3,(H2,12,13) |
| InChIKey | VIDUASVGKDCUKT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |