C12H10FNO5S — CID 146124466
4-fluoro-3-[(furan-3-ylsulfonylamino)methyl]benzoic acid (PubChem CID 146124466) has the molecular formula C12H10FNO5S and a molecular weight of 299.28 g/mol. Its IUPAC name is 4-fluoro-3-[(furan-3-ylsulfonylamino)methyl]benzoic acid.
| Compound Name | 4-fluoro-3-[(furan-3-ylsulfonylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 146124466 |
| Molecular Formula | C12H10FNO5S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 4-fluoro-3-[(furan-3-ylsulfonylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(F)c(CNS(=O)(=O)c2ccoc2)c1 |
| InChI | InChI=1S/C12H10FNO5S/c13-11-2-1-8(12(15)16)5-9(11)6-14-20(17,18)10-3-4-19-7-10/h1-5,7,14H,6H2,(H,15,16) |
| InChIKey | JQXGZHAWROUATG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |