C15H21F3N4O — CID 146125563
[2,2-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone (PubChem CID 146125563) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is [2,2-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone.
| Compound Name | [2,2-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 146125563 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [2,2-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone |
| SMILES | CC1(C)CN(CC(F)(F)F)CCN1C(=O)c1n[nH]c2c1CCC2 |
| InChI | InChI=1S/C15H21F3N4O/c1-14(2)8-21(9-15(16,17)18)6-7-22(14)13(23)12-10-4-3-5-11(10)19-20-12/h3-9H2,1-2H3,(H,19,20) |
| InChIKey | RXVCNRZUEPNDHH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |